We are given the equation $Sem(5 \times 21) = cos(9^\circ) + tan(5x)$ and we need to find the value of $x$. I assume that $Sem$ represents the semiperimeter.

Applied MathematicsTrigonometryEquationsApproximationAngle MeasurementSemiperimeter (assumed)Trigonometric Functions
2025/4/21

1. Problem Description

We are given the equation Sem(5×21)=cos(9)+tan(5x)Sem(5 \times 21) = cos(9^\circ) + tan(5x) and we need to find the value of xx. I assume that SemSem represents the semiperimeter.

2. Solution Steps

First, calculate the value of 5×215 \times 21.
5×21=1055 \times 21 = 105
So the equation becomes Sem(105)=cos(9)+tan(5x)Sem(105) = cos(9^\circ) + tan(5x).
Since SemSem is the semiperimeter, it is not a function, and the semiperimeter of 105 is not uniquely defined.
However, I assume that we are working in degrees.
I also assume that Sem(x)Sem(x) means sin(x)\sin(x). This is the only way the problem makes sense.
Then the equation is sin(105)=cos(9)+tan(5x)\sin(105^\circ) = \cos(9^\circ) + \tan(5x).
We know that sin(105)=sin(180105)=sin(75)\sin(105^\circ) = \sin(180^\circ - 105^\circ) = \sin(75^\circ)
And sin(75)=sin(45+30)=sin(45)cos(30)+cos(45)sin(30)\sin(75^\circ) = \sin(45^\circ + 30^\circ) = \sin(45^\circ)\cos(30^\circ) + \cos(45^\circ)\sin(30^\circ)
=2232+2212=6+24= \frac{\sqrt{2}}{2} \cdot \frac{\sqrt{3}}{2} + \frac{\sqrt{2}}{2} \cdot \frac{1}{2} = \frac{\sqrt{6} + \sqrt{2}}{4}
We also have cos(9)\cos(9^\circ). Using a calculator, cos(9)0.987688\cos(9^\circ) \approx 0.987688.
Also sin(105)0.965926\sin(105^\circ) \approx 0.965926.
Then the equation becomes 0.9659260.987688+tan(5x)0.965926 \approx 0.987688 + \tan(5x).
So tan(5x)0.9659260.987688=0.021762\tan(5x) \approx 0.965926 - 0.987688 = -0.021762.
So 5x=arctan(0.021762)5x = \arctan(-0.021762).
5x1.24695x \approx -1.2469^\circ
x0.24938x \approx -0.24938^\circ
If we assume that Sem(x)Sem(x) stands for simply xx, then the equation is 105=cos(9)+tan(5x)105 = \cos(9^\circ) + \tan(5x).
105cos(9)=tan(5x)105 - \cos(9^\circ) = \tan(5x)
1050.987688=tan(5x)105 - 0.987688 = \tan(5x)
104.012312=tan(5x)104.012312 = \tan(5x)
5x=arctan(104.012312)5x = \arctan(104.012312)
5x=89.450855x = 89.45085^\circ
x=17.89017x = 17.89017^\circ
If Sem(x)Sem(x) stands for sin(x)\sin(x), and all the angles are in radians, then
sin(105)=cos(9)+tan(5x)\sin(105) = \cos(9) + \tan(5x)
0.940230.9912+tan(5x)-0.94023 \approx 0.9912 + \tan(5x)
tan(5x)1.93143\tan(5x) \approx -1.93143
5x1.094525x \approx -1.09452
x0.2189x \approx -0.2189 radians
x12.545x \approx -12.545 degrees.

3. Final Answer

Assuming Sem(x)=sin(x)Sem(x) = sin(x) and the angles are in degrees, x0.24938x \approx -0.24938^\circ.
Assuming Sem(x)=xSem(x) = x and the angles are in degrees, x17.89017x \approx 17.89017^\circ.

Related problems in "Applied Mathematics"

The problem describes the synthesis of proteins involving ribosomes moving along an mRNA molecule (A...

BiologyLinear EquationsUnits ConversionRate
2025/6/6

The problem asks to calculate the pressure exerted by a car on the road, given the total force exert...

PhysicsPressureForceAreaUnits
2025/6/5

The problem asks us to calculate the pressure exerted by a block on the ground in two different scen...

PhysicsPressureForceAreaUnits
2025/6/5

The problem provides the pressure exerted by a brick on a table ($240 \ N/m^2$) and the area of the ...

PhysicsPressureForceAreaUnits Conversion
2025/6/5

The problem describes an mRNA molecule (ARNm) consisting of 1800 ribonucleotides. This mRNA is used ...

BiologyBiochemistrymRNAProtein SynthesisLinear EquationsAlgebra
2025/6/5

The price of milk is currently $3.89 per gallon and has been increasing by 5% per year. We need to c...

Compound InterestPercentage IncreaseFinancial MathematicsExponential Growth
2025/6/4

The questions ask for: - Abu's share of the profit. - Ojo's share of the profit for the year. - The ...

Profit SharingAccountingFinancial Mathematics
2025/6/4

We are given some information from a bank statement and need to calculate the adjusted cash book bal...

AccountingFinancial StatementsCash BookBank ReconciliationGross Profit
2025/6/4

The problem provides information about a gene with a total molecular mass of 360,000 carbon units. A...

BiologyGeneticsMolecular BiologyBiochemistryNucleotide CalculationAmino Acid CalculationmRNA SequenceCodons
2025/6/4

A company produces two types of lamps, $L_1$ and $L_2$. Manufacturing $L_1$ requires 20 minutes of m...

Linear ProgrammingOptimizationConstraintsObjective Function
2025/6/4