Solve the differential equation $(D^2 + 9)y = \cos^3x$.

Applied MathematicsDifferential EquationsOrdinary Differential EquationsSecond Order ODEHomogeneous EquationsParticular IntegralTrigonometric Functions
2025/4/22

1. Problem Description

Solve the differential equation (D2+9)y=cos3x(D^2 + 9)y = \cos^3x.

2. Solution Steps

The given differential equation is (D2+9)y=cos3x(D^2 + 9)y = \cos^3x.
First, we find the complementary function by solving the homogeneous equation (D2+9)y=0(D^2 + 9)y = 0. The auxiliary equation is m2+9=0m^2 + 9 = 0, which gives m=±3im = \pm 3i. Thus, the complementary function is yc=c1cos(3x)+c2sin(3x)y_c = c_1 \cos(3x) + c_2 \sin(3x).
Next, we find the particular integral. Since cos3x=14(3cosx+cos3x)\cos^3x = \frac{1}{4}(3 \cos x + \cos 3x), the equation becomes (D2+9)y=14(3cosx+cos3x)(D^2 + 9)y = \frac{1}{4}(3 \cos x + \cos 3x).
We can write the particular integral as yp=yp1+yp2y_p = y_{p1} + y_{p2}, where (D2+9)yp1=34cosx(D^2 + 9)y_{p1} = \frac{3}{4} \cos x and (D2+9)yp2=14cos3x(D^2 + 9)y_{p2} = \frac{1}{4} \cos 3x.
For yp1y_{p1}, we assume yp1=Acosxy_{p1} = A \cos x. Then D2yp1=AcosxD^2 y_{p1} = -A \cos x.
Substituting into (D2+9)yp1=34cosx(D^2 + 9)y_{p1} = \frac{3}{4} \cos x, we get (Acosx+9Acosx)=34cosx(-A \cos x + 9A \cos x) = \frac{3}{4} \cos x, which gives 8A=348A = \frac{3}{4}, so A=332A = \frac{3}{32}.
Thus, yp1=332cosxy_{p1} = \frac{3}{32} \cos x.
For yp2y_{p2}, we assume yp2=Bxsin3xy_{p2} = Bx \sin 3x (since cos3x\cos 3x is a part of the complementary function).
Then Dyp2=Bsin3x+3Bxcos3xDy_{p2} = B \sin 3x + 3Bx \cos 3x, and D2yp2=3Bcos3x+3Bcos3x9Bxsin3x=6Bcos3x9Bxsin3xD^2 y_{p2} = 3B \cos 3x + 3B \cos 3x - 9Bx \sin 3x = 6B \cos 3x - 9Bx \sin 3x.
Substituting into (D2+9)yp2=14cos3x(D^2 + 9)y_{p2} = \frac{1}{4} \cos 3x, we have (6Bcos3x9Bxsin3x+9Bxsin3x)=14cos3x(6B \cos 3x - 9Bx \sin 3x + 9Bx \sin 3x) = \frac{1}{4} \cos 3x, which simplifies to 6Bcos3x=14cos3x6B \cos 3x = \frac{1}{4} \cos 3x.
Thus, 6B=146B = \frac{1}{4}, so B=124B = \frac{1}{24}.
Therefore, yp2=124xsin3xy_{p2} = \frac{1}{24}x \sin 3x.
The general solution is y=yc+yp1+yp2=c1cos3x+c2sin3x+332cosx+124xsin3xy = y_c + y_{p1} + y_{p2} = c_1 \cos 3x + c_2 \sin 3x + \frac{3}{32} \cos x + \frac{1}{24}x \sin 3x.

3. Final Answer

y=c1cos3x+c2sin3x+332cosx+124xsin3xy = c_1 \cos 3x + c_2 \sin 3x + \frac{3}{32} \cos x + \frac{1}{24} x \sin 3x

Related problems in "Applied Mathematics"

The problem describes the synthesis of proteins involving ribosomes moving along an mRNA molecule (A...

BiologyLinear EquationsUnits ConversionRate
2025/6/6

The problem asks to calculate the pressure exerted by a car on the road, given the total force exert...

PhysicsPressureForceAreaUnits
2025/6/5

The problem asks us to calculate the pressure exerted by a block on the ground in two different scen...

PhysicsPressureForceAreaUnits
2025/6/5

The problem provides the pressure exerted by a brick on a table ($240 \ N/m^2$) and the area of the ...

PhysicsPressureForceAreaUnits Conversion
2025/6/5

The problem describes an mRNA molecule (ARNm) consisting of 1800 ribonucleotides. This mRNA is used ...

BiologyBiochemistrymRNAProtein SynthesisLinear EquationsAlgebra
2025/6/5

The price of milk is currently $3.89 per gallon and has been increasing by 5% per year. We need to c...

Compound InterestPercentage IncreaseFinancial MathematicsExponential Growth
2025/6/4

The questions ask for: - Abu's share of the profit. - Ojo's share of the profit for the year. - The ...

Profit SharingAccountingFinancial Mathematics
2025/6/4

We are given some information from a bank statement and need to calculate the adjusted cash book bal...

AccountingFinancial StatementsCash BookBank ReconciliationGross Profit
2025/6/4

The problem provides information about a gene with a total molecular mass of 360,000 carbon units. A...

BiologyGeneticsMolecular BiologyBiochemistryNucleotide CalculationAmino Acid CalculationmRNA SequenceCodons
2025/6/4

A company produces two types of lamps, $L_1$ and $L_2$. Manufacturing $L_1$ requires 20 minutes of m...

Linear ProgrammingOptimizationConstraintsObjective Function
2025/6/4