The problem asks to name the given organic compounds (alkanes) based on their structures and write out all the possible non-cyclic isomers for $C_5H_{12}$, $C_6H_{12}$ and $C_7H_{12}$, then name each isomer.

OtherOrganic ChemistryIsomersNomenclatureAlkanesStructural Formulas
2025/4/21

1. Problem Description

The problem asks to name the given organic compounds (alkanes) based on their structures and write out all the possible non-cyclic isomers for C5H12C_5H_{12}, C6H12C_6H_{12} and C7H12C_7H_{12}, then name each isomer.

2. Solution Steps

Part 1: Naming the compounds
a) CH3CH(CH3)CH(CH3)CH2CH3CH_3-CH(CH_3)-CH(CH_3)-CH_2-CH_3
The longest chain has 5 carbons. Number the chain such that the substituents have the lowest possible numbers. The compound has methyl groups at positions 2 and

3. Therefore, the name is 2,3-dimethylpentane.

b) CH3C(CH3)2CH3CH_3-C(CH_3)_2-CH_3
The longest chain has 3 carbons. There are two methyl groups attached to carbon

2. Therefore, the name is 2,2-dimethylpropane.

c) CH3C(CH3)(C4H9)CHCH3(CH2CH3)CH_3-C(CH_3)(C_4H_9)-CH-CH_3(CH_2-CH_3)
This compound is written in a confusing way. Let us re-draw the compound: CH3C(CH3)(CH2CH2CH2CH3)CH(CH2CH3)CH3CH_3-C(CH_3)(CH_2CH_2CH_2CH_3)-CH(CH_2CH_3)-CH_3. The longest chain has 6 carbons. So it is a hexane. The numbering should start from the left. There is a methyl group at carbon 2 and a butyl group on the same carbon, and an ethyl group on carbon

3. The name is 3-ethyl-2-methyl-2-butylhexane. However, the butyl group has formula $C_4H_9$, which suggests an error since there is an alkyl group, $C_2H_5$, on carbon

3. In the original image, there is $C_4H_9$ on the compound. But if we change this to $CH_2CH_2CH_2CH_3$, the correct name is 3-ethyl-2-methylhexane. I will assume that the structure should be $CH_3-C(CH_3)(CH_2CH_2CH_2CH_3)-CH(CH_2CH_3)-CH_3$ so the name is 3-ethyl-2-methylhexane.

d) CH3CH2C(CH2CH3)2CH2CH3CH_3-CH_2-C(CH_2-CH_3)_2-CH_2-CH_3
The longest chain has 5 carbons. There are two ethyl groups attached to carbon

3. Thus, it is 3,3-diethylpentane.

e) CH3CH(CH3)CH(CH2CH3)CH(CH3)CH2CH2CH3CH_3-CH(CH_3)-CH(CH_2CH_3)-CH(CH_3)-CH_2-CH_2-CH_3
The longest chain has 7 carbons. There is a methyl group at carbon 2, an ethyl group at carbon 3 and a methyl group at carbon

4. Thus, it is 3-ethyl-2,4-dimethylheptane.

f) CH3C(CH3)(CH2CH3)C(CH3)(CH2CH3)CH2CH3CH_3-C(CH_3)(CH_2CH_3)-C(CH_3)(CH_2CH_3)-CH_2-CH_3
The longest chain has 6 carbons. There is a methyl and ethyl group attached to carbon

2. There is a methyl and ethyl group attached to carbon

3. Thus, it is 2,3-diethyl-2,3-dimethylhexane.

Part 2: Writing isomers and naming them.
C5H12C_5H_{12}:

1. Pentane: $CH_3-CH_2-CH_2-CH_2-CH_3$

2. 2-Methylbutane (Isopentane): $CH_3-CH(CH_3)-CH_2-CH_3$

3. 2,2-Dimethylpropane (Neopentane): $CH_3-C(CH_3)_2-CH_3$

C6H14C_6H_{14}:

1. Hexane: $CH_3-CH_2-CH_2-CH_2-CH_2-CH_3$

2. 2-Methylpentane: $CH_3-CH(CH_3)-CH_2-CH_2-CH_3$

3. 3-Methylpentane: $CH_3-CH_2-CH(CH_3)-CH_2-CH_3$

4. 2,2-Dimethylbutane: $CH_3-C(CH_3)_2-CH_2-CH_3$

5. 2,3-Dimethylbutane: $CH_3-CH(CH_3)-CH(CH_3)-CH_3$

C7H16C_7H_{16}:

1. Heptane: $CH_3-CH_2-CH_2-CH_2-CH_2-CH_2-CH_3$

2. 2-Methylhexane: $CH_3-CH(CH_3)-CH_2-CH_2-CH_2-CH_3$

3. 3-Methylhexane: $CH_3-CH_2-CH(CH_3)-CH_2-CH_2-CH_3$

4. 2,2-Dimethylpentane: $CH_3-C(CH_3)_2-CH_2-CH_2-CH_3$

5. 2,3-Dimethylpentane: $CH_3-CH(CH_3)-CH(CH_3)-CH_2-CH_3$

6. 2,4-Dimethylpentane: $CH_3-CH(CH_3)-CH_2-CH(CH_3)-CH_3$

7. 3,3-Dimethylpentane: $CH_3-CH_2-C(CH_3)_2-CH_2-CH_3$

8. 3-Ethylpentane: $CH_3-CH_2-CH(CH_2CH_3)-CH_2-CH_3$

9. 2,2,3-Trimethylbutane: $CH_3-C(CH_3)_2-CH(CH_3)-CH_3$

3. Final Answer

a) 2,3-dimethylpentane
b) 2,2-dimethylpropane
c) 3-ethyl-2-methylhexane
d) 3,3-diethylpentane
e) 3-ethyl-2,4-dimethylheptane
f) 3,4-diethyl-3,4-dimethylhexane. But the longest chain must be 7 carbons. The name is 2,3-diethyl-2,3-dimethylhexane.
C5H12C_5H_{12}: Pentane, 2-Methylbutane, 2,2-Dimethylpropane
C6H14C_6H_{14}: Hexane, 2-Methylpentane, 3-Methylpentane, 2,2-Dimethylbutane, 2,3-Dimethylbutane
C7H16C_7H_{16}: Heptane, 2-Methylhexane, 3-Methylhexane, 2,2-Dimethylpentane, 2,3-Dimethylpentane, 2,4-Dimethylpentane, 3,3-Dimethylpentane, 3-Ethylpentane, 2,2,3-Trimethylbutane

Related problems in "Other"

Question 9: Given the C++ code: ```cpp int a = 3; int b = 2; cout << a % b; ``` What does the code d...

Computer ScienceC++ ProgrammingModulo OperatorInteger VariablesCode Execution
2025/6/23

The problem is to match the descriptions in Column A with the correct terms in Column B.

DefinitionsSet TheoryNumber SystemsPropositional Logic
2025/6/8

Due to the image quality and the language used, I cannot understand the mathematical problem being p...

Unclear ProblemNumerical ValuesAmbiguous
2025/6/3

We need to evaluate the expression: $\frac{sin(\frac{2\pi}{3}) + cos(\frac{\pi}{4})}{tan(\frac{\pi}{...

TrigonometryTrigonometric FunctionsExpression EvaluationRadians
2025/5/22

The image presents a math exam with several problems related to complex numbers, limits, integrals, ...

Complex NumbersLimitsIntegralsDifferential Equations3D GeometryAlgebraTrigonometry
2025/5/11

The problem has three parts: (i) Differentiate $y = 2x^3 \sin 2x$ with respect to $x$. (ii) Simplify...

DifferentiationProduct RuleExponentsComplex NumbersSimplificationComplex Conjugate
2025/5/8

We are given three problems: a) Given two sets $M$ and $N$, find their union and intersection. $M$ i...

Set TheoryArithmeticGeometryOrder of OperationsAnglesStraight LinesRatio and Proportion
2025/4/29

We are asked to prove the trigonometric identity: $1 - 2\cos^2{t} = \frac{\tan^2{t} - 1}{\tan^2{t} +...

TrigonometryTrigonometric IdentitiesProofs
2025/4/28

The problem is to simplify the expression $\sin^2{\alpha} + \sin{\alpha}\cos^2{\alpha}$.

TrigonometryTrigonometric IdentitiesExpression Simplification
2025/4/25

The problem defines a function $G$ that takes a student's first name as input and returns the number...

FunctionsString ManipulationCounting
2025/4/24